C13H12F2N4O2 — CID 122301865
1-(2,4-difluorophenyl)-3-(2-ethoxypyrimidin-5-yl)urea (PubChem CID 122301865) has the molecular formula C13H12F2N4O2 and a molecular weight of 294.26 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(2-ethoxypyrimidin-5-yl)urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(2-ethoxypyrimidin-5-yl)urea |
|---|---|
| PubChem CID | 122301865 |
| Molecular Formula | C13H12F2N4O2 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(2-ethoxypyrimidin-5-yl)urea |
| SMILES | CCOc1ncc(NC(=O)Nc2ccc(F)cc2F)cn1 |
| InChI | InChI=1S/C13H12F2N4O2/c1-2-21-13-16-6-9(7-17-13)18-12(20)19-11-4-3-8(14)5-10(11)15/h3-7H,2H2,1H3,(H2,18,19,20) |
| InChIKey | JJTQYIRSBDAUOI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |