C14H13F3N4O3 — CID 122301912
1-(2-ethoxypyrimidin-5-yl)-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 122301912) has the molecular formula C14H13F3N4O3 and a molecular weight of 342.28 g/mol. Its IUPAC name is 1-(2-ethoxypyrimidin-5-yl)-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-(2-ethoxypyrimidin-5-yl)-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 122301912 |
| Molecular Formula | C14H13F3N4O3 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 1-(2-ethoxypyrimidin-5-yl)-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | CCOc1ncc(NC(=O)Nc2ccc(OC(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C14H13F3N4O3/c1-2-23-13-18-7-10(8-19-13)21-12(22)20-9-3-5-11(6-4-9)24-14(15,16)17/h3-8H,2H2,1H3,(H2,20,21,22) |
| InChIKey | WFMWITPUNDYSEZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |