C13H11F3N4O3 — CID 122301480
1-(2-methoxypyrimidin-5-yl)-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 122301480) has the molecular formula C13H11F3N4O3 and a molecular weight of 328.25 g/mol. Its IUPAC name is 1-(2-methoxypyrimidin-5-yl)-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-(2-methoxypyrimidin-5-yl)-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 122301480 |
| Molecular Formula | C13H11F3N4O3 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 1-(2-methoxypyrimidin-5-yl)-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | COc1ncc(NC(=O)Nc2ccc(OC(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C13H11F3N4O3/c1-22-12-17-6-9(7-18-12)20-11(21)19-8-2-4-10(5-3-8)23-13(14,15)16/h2-7H,1H3,(H2,19,20,21) |
| InChIKey | YRPPGUGHPMDBLY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |