C14H9F5N2O2 — CID 71568254
1-(3,5-difluorophenyl)-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 71568254) has the molecular formula C14H9F5N2O2 and a molecular weight of 332.23 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-(3,5-difluorophenyl)-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 71568254 |
| Molecular Formula | C14H9F5N2O2 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 1-(3,5-difluorophenyl)-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H9F5N2O2/c15-8-5-9(16)7-11(6-8)21-13(22)20-10-1-3-12(4-2-10)23-14(17,18)19/h1-7H,(H2,20,21,22) |
| InChIKey | KAWOWIQMFXXSSD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |