C15H12F4N2O2 — CID 46860155
1-(3-fluoro-2-methylphenyl)-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 46860155) has the molecular formula C15H12F4N2O2 and a molecular weight of 328.27 g/mol. Its IUPAC name is 1-(3-fluoro-2-methylphenyl)-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-(3-fluoro-2-methylphenyl)-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 46860155 |
| Molecular Formula | C15H12F4N2O2 |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 1-(3-fluoro-2-methylphenyl)-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | Cc1c(F)cccc1NC(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H12F4N2O2/c1-9-12(16)3-2-4-13(9)21-14(22)20-10-5-7-11(8-6-10)23-15(17,18)19/h2-8H,1H3,(H2,20,21,22) |
| InChIKey | IKAINBYRUYPWRT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |