C14H14FN3O3S — CID 46860176
1-(3-fluoro-2-methylphenyl)-3-(4-sulfamoylphenyl)urea (PubChem CID 46860176) has the molecular formula C14H14FN3O3S and a molecular weight of 323.35 g/mol. Its IUPAC name is 1-(3-fluoro-2-methylphenyl)-3-(4-sulfamoylphenyl)urea.
| Compound Name | 1-(3-fluoro-2-methylphenyl)-3-(4-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 46860176 |
| Molecular Formula | C14H14FN3O3S |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 1-(3-fluoro-2-methylphenyl)-3-(4-sulfamoylphenyl)urea |
| SMILES | Cc1c(F)cccc1NC(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C14H14FN3O3S/c1-9-12(15)3-2-4-13(9)18-14(19)17-10-5-7-11(8-6-10)22(16,20)21/h2-8H,1H3,(H2,16,20,21)(H2,17,18,19) |
| InChIKey | BGLDRLVWIBSQSF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |