C15H17N3O5S — CID 108867832
1-(2,6-dimethoxyphenyl)-3-(4-sulfamoylphenyl)urea (PubChem CID 108867832) has the molecular formula C15H17N3O5S and a molecular weight of 351.38 g/mol. Its IUPAC name is 1-(2,6-dimethoxyphenyl)-3-(4-sulfamoylphenyl)urea.
| Compound Name | 1-(2,6-dimethoxyphenyl)-3-(4-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 108867832 |
| Molecular Formula | C15H17N3O5S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 1-(2,6-dimethoxyphenyl)-3-(4-sulfamoylphenyl)urea |
| SMILES | COc1cccc(OC)c1NC(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H17N3O5S/c1-22-12-4-3-5-13(23-2)14(12)18-15(19)17-10-6-8-11(9-7-10)24(16,20)21/h3-9H,1-2H3,(H2,16,20,21)(H2,17,18,19) |
| InChIKey | KZVHBEYNAGDTDY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |