C16H19N3O4S — CID 108878284
1-[(2,3-dimethylphenoxy)methyl]-3-(4-sulfamoylphenyl)urea (PubChem CID 108878284) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is 1-[(2,3-dimethylphenoxy)methyl]-3-(4-sulfamoylphenyl)urea.
| Compound Name | 1-[(2,3-dimethylphenoxy)methyl]-3-(4-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 108878284 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 1-[(2,3-dimethylphenoxy)methyl]-3-(4-sulfamoylphenyl)urea |
| SMILES | Cc1cccc(OCNC(=O)Nc2ccc(S(N)(=O)=O)cc2)c1C |
| InChI | InChI=1S/C16H19N3O4S/c1-11-4-3-5-15(12(11)2)23-10-18-16(20)19-13-6-8-14(9-7-13)24(17,21)22/h3-9H,10H2,1-2H3,(H2,17,21,22)(H2,18,19,20) |
| InChIKey | XWLWLFWSQKDZQF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|