C20H20N2O3 — CID 108878287
1-[(2,3-dimethylphenoxy)methyl]-3-(5-hydroxynaphthalen-1-yl)urea (PubChem CID 108878287) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 1-[(2,3-dimethylphenoxy)methyl]-3-(5-hydroxynaphthalen-1-yl)urea.
| Compound Name | 1-[(2,3-dimethylphenoxy)methyl]-3-(5-hydroxynaphthalen-1-yl)urea |
|---|---|
| PubChem CID | 108878287 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 1-[(2,3-dimethylphenoxy)methyl]-3-(5-hydroxynaphthalen-1-yl)urea |
| SMILES | Cc1cccc(OCNC(=O)Nc2cccc3c(O)cccc23)c1C |
| InChI | InChI=1S/C20H20N2O3/c1-13-6-3-11-19(14(13)2)25-12-21-20(24)22-17-9-4-8-16-15(17)7-5-10-18(16)23/h3-11,23H,12H2,1-2H3,(H2,21,22,24) |
| InChIKey | DNKIXACTVACAAC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|