C17H20N2O3 — CID 108880185
1-(2-hydroxyphenyl)-3-[(2,3,6-trimethylphenoxy)methyl]urea (PubChem CID 108880185) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 1-(2-hydroxyphenyl)-3-[(2,3,6-trimethylphenoxy)methyl]urea.
| Compound Name | 1-(2-hydroxyphenyl)-3-[(2,3,6-trimethylphenoxy)methyl]urea |
|---|---|
| PubChem CID | 108880185 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 1-(2-hydroxyphenyl)-3-[(2,3,6-trimethylphenoxy)methyl]urea |
| SMILES | Cc1ccc(C)c(OCNC(=O)Nc2ccccc2O)c1C |
| InChI | InChI=1S/C17H20N2O3/c1-11-8-9-12(2)16(13(11)3)22-10-18-17(21)19-14-6-4-5-7-15(14)20/h4-9,20H,10H2,1-3H3,(H2,18,19,21) |
| InChIKey | YENHGTDKKRWNIG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|