C16H18N2O2 — CID 108888843
1-(2,3-dimethylphenyl)-3-(phenoxymethyl)urea (PubChem CID 108888843) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-(phenoxymethyl)urea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-(phenoxymethyl)urea |
|---|---|
| PubChem CID | 108888843 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-(phenoxymethyl)urea |
| SMILES | Cc1cccc(NC(=O)NCOc2ccccc2)c1C |
| InChI | InChI=1S/C16H18N2O2/c1-12-7-6-10-15(13(12)2)18-16(19)17-11-20-14-8-4-3-5-9-14/h3-10H,11H2,1-2H3,(H2,17,18,19) |
| InChIKey | WRAYDINNRZBNIE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|