C19H24N2O2 — CID 108880131
1-(2-phenylethyl)-3-[(2,3,6-trimethylphenoxy)methyl]urea (PubChem CID 108880131) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-(2-phenylethyl)-3-[(2,3,6-trimethylphenoxy)methyl]urea.
| Compound Name | 1-(2-phenylethyl)-3-[(2,3,6-trimethylphenoxy)methyl]urea |
|---|---|
| PubChem CID | 108880131 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 1-(2-phenylethyl)-3-[(2,3,6-trimethylphenoxy)methyl]urea |
| SMILES | Cc1ccc(C)c(OCNC(=O)NCCc2ccccc2)c1C |
| InChI | InChI=1S/C19H24N2O2/c1-14-9-10-15(2)18(16(14)3)23-13-21-19(22)20-12-11-17-7-5-4-6-8-17/h4-10H,11-13H2,1-3H3,(H2,20,21,22) |
| InChIKey | NRFOOGNTQRIPAI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|