C18H21FN2O2 — CID 108878491
1-[(2,3-dimethylphenoxy)methyl]-3-[2-(4-fluorophenyl)ethyl]urea (PubChem CID 108878491) has the molecular formula C18H21FN2O2 and a molecular weight of 316.38 g/mol. Its IUPAC name is 1-[(2,3-dimethylphenoxy)methyl]-3-[2-(4-fluorophenyl)ethyl]urea.
| Compound Name | 1-[(2,3-dimethylphenoxy)methyl]-3-[2-(4-fluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 108878491 |
| Molecular Formula | C18H21FN2O2 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 1-[(2,3-dimethylphenoxy)methyl]-3-[2-(4-fluorophenyl)ethyl]urea |
| SMILES | Cc1cccc(OCNC(=O)NCCc2ccc(F)cc2)c1C |
| InChI | InChI=1S/C18H21FN2O2/c1-13-4-3-5-17(14(13)2)23-12-21-18(22)20-11-10-15-6-8-16(19)9-7-15/h3-9H,10-12H2,1-2H3,(H2,20,21,22) |
| InChIKey | YWWHYMGYKNJDAK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|