C15H25N3O2 — CID 108878398
1-[3-(dimethylamino)propyl]-3-[(2,3-dimethylphenoxy)methyl]urea (PubChem CID 108878398) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-3-[(2,3-dimethylphenoxy)methyl]urea.
| Compound Name | 1-[3-(dimethylamino)propyl]-3-[(2,3-dimethylphenoxy)methyl]urea |
|---|---|
| PubChem CID | 108878398 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3-[(2,3-dimethylphenoxy)methyl]urea |
| SMILES | Cc1cccc(OCNC(=O)NCCCN(C)C)c1C |
| InChI | InChI=1S/C15H25N3O2/c1-12-7-5-8-14(13(12)2)20-11-17-15(19)16-9-6-10-18(3)4/h5,7-8H,6,9-11H2,1-4H3,(H2,16,17,19) |
| InChIKey | LSBLWZCXBSBOKO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|