C16H24N2O4 — CID 122012189
3-[3-(2,3-dimethylphenoxy)propylcarbamoyl-methylamino]propanoic acid (PubChem CID 122012189) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 3-[3-(2,3-dimethylphenoxy)propylcarbamoyl-methylamino]propanoic acid.
| Compound Name | 3-[3-(2,3-dimethylphenoxy)propylcarbamoyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 122012189 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 3-[3-(2,3-dimethylphenoxy)propylcarbamoyl-methylamino]propanoic acid |
| SMILES | Cc1cccc(OCCCNC(=O)N(C)CCC(=O)O)c1C |
| InChI | InChI=1S/C16H24N2O4/c1-12-6-4-7-14(13(12)2)22-11-5-9-17-16(21)18(3)10-8-15(19)20/h4,6-7H,5,8-11H2,1-3H3,(H,17,21)(H,19,20) |
| InChIKey | OACSCOHYBYYOCU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|