C20H25N3O2S — CID 54217764
3-[2-[[2-(2,3-dimethylphenoxy)ethanethioyl]amino]ethyl]-1-methyl-1-phenylurea (PubChem CID 54217764) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is 3-[2-[[2-(2,3-dimethylphenoxy)ethanethioyl]amino]ethyl]-1-methyl-1-phenylurea.
| Compound Name | 3-[2-[[2-(2,3-dimethylphenoxy)ethanethioyl]amino]ethyl]-1-methyl-1-phenylurea |
|---|---|
| PubChem CID | 54217764 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 3-[2-[[2-(2,3-dimethylphenoxy)ethanethioyl]amino]ethyl]-1-methyl-1-phenylurea |
| SMILES | Cc1cccc(OCC(=S)NCCNC(=O)N(C)c2ccccc2)c1C |
| InChI | InChI=1S/C20H25N3O2S/c1-15-8-7-11-18(16(15)2)25-14-19(26)21-12-13-22-20(24)23(3)17-9-5-4-6-10-17/h4-11H,12-14H2,1-3H3,(H,21,26)(H,22,24) |
| InChIKey | QAKAQTSSJNMFSR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|