C19H23NO2 — CID 133144199
2-(2,3-dimethylphenoxy)-N-methyl-N-phenylbutanamide (PubChem CID 133144199) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-(2,3-dimethylphenoxy)-N-methyl-N-phenylbutanamide.
| Compound Name | 2-(2,3-dimethylphenoxy)-N-methyl-N-phenylbutanamide |
|---|---|
| PubChem CID | 133144199 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 2-(2,3-dimethylphenoxy)-N-methyl-N-phenylbutanamide |
| SMILES | CCC(Oc1cccc(C)c1C)C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C19H23NO2/c1-5-17(22-18-13-9-10-14(2)15(18)3)19(21)20(4)16-11-7-6-8-12-16/h6-13,17H,5H2,1-4H3 |
| InChIKey | ARTPTICSDNPIPZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |