C29H34N2O2 — CID 92685129
(2S)-1-(4-benzhydrylpiperazin-1-yl)-2-(2,3-dimethylphenoxy)butan-1-one (PubChem CID 92685129) has the molecular formula C29H34N2O2 and a molecular weight of 442.60 g/mol. Its IUPAC name is (2S)-1-(4-benzhydrylpiperazin-1-yl)-2-(2,3-dimethylphenoxy)butan-1-one.
| Compound Name | (2S)-1-(4-benzhydrylpiperazin-1-yl)-2-(2,3-dimethylphenoxy)butan-1-one |
|---|---|
| PubChem CID | 92685129 |
| Molecular Formula | C29H34N2O2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | (2S)-1-(4-benzhydrylpiperazin-1-yl)-2-(2,3-dimethylphenoxy)butan-1-one |
| SMILES | CC[C@H](Oc1cccc(C)c1C)C(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C29H34N2O2/c1-4-26(33-27-17-11-12-22(2)23(27)3)29(32)31-20-18-30(19-21-31)28(24-13-7-5-8-14-24)25-15-9-6-10-16-25/h5-17,26,28H,4,18-21H2,1-3H3/t26-/m0/s1 |
| InChIKey | CLTQCETXPRHVKT-SANMLTNESA-N |
| XLogP | 5.39 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |