C31H38N2O2 — CID 17150689
1-(4-benzhydrylpiperazin-1-yl)-2-(2-butan-2-ylphenoxy)butan-1-one (PubChem CID 17150689) has the molecular formula C31H38N2O2 and a molecular weight of 470.66 g/mol. Its IUPAC name is 1-(4-benzhydrylpiperazin-1-yl)-2-(2-butan-2-ylphenoxy)butan-1-one.
| Compound Name | 1-(4-benzhydrylpiperazin-1-yl)-2-(2-butan-2-ylphenoxy)butan-1-one |
|---|---|
| PubChem CID | 17150689 |
| Molecular Formula | C31H38N2O2 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | 1-(4-benzhydrylpiperazin-1-yl)-2-(2-butan-2-ylphenoxy)butan-1-one |
| SMILES | CCC(Oc1ccccc1C(C)CC)C(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C31H38N2O2/c1-4-24(3)27-18-12-13-19-29(27)35-28(5-2)31(34)33-22-20-32(21-23-33)30(25-14-8-6-9-15-25)26-16-10-7-11-17-26/h6-19,24,28,30H,4-5,20-23H2,1-3H3 |
| InChIKey | LOTAKCFIVYMZHC-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |