C28H32N2O2 — CID 4945513
1-(4-benzhydrylpiperazin-1-yl)-2-(2-methylphenoxy)butan-1-one (PubChem CID 4945513) has the molecular formula C28H32N2O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 1-(4-benzhydrylpiperazin-1-yl)-2-(2-methylphenoxy)butan-1-one.
| Compound Name | 1-(4-benzhydrylpiperazin-1-yl)-2-(2-methylphenoxy)butan-1-one |
|---|---|
| PubChem CID | 4945513 |
| Molecular Formula | C28H32N2O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 1-(4-benzhydrylpiperazin-1-yl)-2-(2-methylphenoxy)butan-1-one |
| SMILES | CCC(Oc1ccccc1C)C(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H32N2O2/c1-3-25(32-26-17-11-10-12-22(26)2)28(31)30-20-18-29(19-21-30)27(23-13-6-4-7-14-23)24-15-8-5-9-16-24/h4-17,25,27H,3,18-21H2,1-2H3 |
| InChIKey | ZCEBEZXMHDSBRJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |