C26H28N2O3 — CID 108538583
N-[2-[[2-(2,3-dimethylphenoxy)acetyl]amino]ethyl]-2,2-diphenylacetamide (PubChem CID 108538583) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is N-[2-[[2-(2,3-dimethylphenoxy)acetyl]amino]ethyl]-2,2-diphenylacetamide.
| Compound Name | N-[2-[[2-(2,3-dimethylphenoxy)acetyl]amino]ethyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 108538583 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | N-[2-[[2-(2,3-dimethylphenoxy)acetyl]amino]ethyl]-2,2-diphenylacetamide |
| SMILES | Cc1cccc(OCC(=O)NCCNC(=O)C(c2ccccc2)c2ccccc2)c1C |
| InChI | InChI=1S/C26H28N2O3/c1-19-10-9-15-23(20(19)2)31-18-24(29)27-16-17-28-26(30)25(21-11-5-3-6-12-21)22-13-7-4-8-14-22/h3-15,25H,16-18H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | HXNFQBKVTNPQOG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|