C23H28N2O4 — CID 108540659
N-[2-[[2-(2,3-dimethylphenoxy)acetyl]amino]ethyl]-4-(4-methylphenyl)-4-oxobutanamide (PubChem CID 108540659) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[2-[[2-(2,3-dimethylphenoxy)acetyl]amino]ethyl]-4-(4-methylphenyl)-4-oxobutanamide.
| Compound Name | N-[2-[[2-(2,3-dimethylphenoxy)acetyl]amino]ethyl]-4-(4-methylphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 108540659 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-[2-[[2-(2,3-dimethylphenoxy)acetyl]amino]ethyl]-4-(4-methylphenyl)-4-oxobutanamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)NCCNC(=O)COc2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C23H28N2O4/c1-16-7-9-19(10-8-16)20(26)11-12-22(27)24-13-14-25-23(28)15-29-21-6-4-5-17(2)18(21)3/h4-10H,11-15H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | IMFYMUASBKHOOR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|