C18H26N2O3 — CID 108540704
2,2-dimethyl-N-[2-[[4-(4-methylphenyl)-4-oxobutanoyl]amino]ethyl]propanamide (PubChem CID 108540704) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-[[4-(4-methylphenyl)-4-oxobutanoyl]amino]ethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[2-[[4-(4-methylphenyl)-4-oxobutanoyl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 108540704 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 2,2-dimethyl-N-[2-[[4-(4-methylphenyl)-4-oxobutanoyl]amino]ethyl]propanamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)NCCNC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H26N2O3/c1-13-5-7-14(8-6-13)15(21)9-10-16(22)19-11-12-20-17(23)18(2,3)4/h5-8H,9-12H2,1-4H3,(H,19,22)(H,20,23) |
| InChIKey | WDCATLYCIXKNPH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|