C20H21ClN2O3 — CID 108539491
3-chloro-N-[2-[[4-(4-methylphenyl)-4-oxobutanoyl]amino]ethyl]benzamide (PubChem CID 108539491) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is 3-chloro-N-[2-[[4-(4-methylphenyl)-4-oxobutanoyl]amino]ethyl]benzamide.
| Compound Name | 3-chloro-N-[2-[[4-(4-methylphenyl)-4-oxobutanoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 108539491 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 3-chloro-N-[2-[[4-(4-methylphenyl)-4-oxobutanoyl]amino]ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)NCCNC(=O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C20H21ClN2O3/c1-14-5-7-15(8-6-14)18(24)9-10-19(25)22-11-12-23-20(26)16-3-2-4-17(21)13-16/h2-8,13H,9-12H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | MTAFSGBFLWYVLL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|