C20H21FN2O3 — CID 108538205
2-fluoro-N-[2-[[4-(4-methylphenyl)-4-oxobutanoyl]amino]ethyl]benzamide (PubChem CID 108538205) has the molecular formula C20H21FN2O3 and a molecular weight of 356.40 g/mol. Its IUPAC name is 2-fluoro-N-[2-[[4-(4-methylphenyl)-4-oxobutanoyl]amino]ethyl]benzamide.
| Compound Name | 2-fluoro-N-[2-[[4-(4-methylphenyl)-4-oxobutanoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 108538205 |
| Molecular Formula | C20H21FN2O3 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-fluoro-N-[2-[[4-(4-methylphenyl)-4-oxobutanoyl]amino]ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)NCCNC(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C20H21FN2O3/c1-14-6-8-15(9-7-14)18(24)10-11-19(25)22-12-13-23-20(26)16-4-2-3-5-17(16)21/h2-9H,10-13H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | YLNIUZVZUUGKTC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|