C20H22FN3O3S — CID 55982413
2-fluoro-N-[2-[[2-[2-(4-methylanilino)-2-oxoethyl]sulfanylacetyl]amino]ethyl]benzamide (PubChem CID 55982413) has the molecular formula C20H22FN3O3S and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-fluoro-N-[2-[[2-[2-(4-methylanilino)-2-oxoethyl]sulfanylacetyl]amino]ethyl]benzamide.
| Compound Name | 2-fluoro-N-[2-[[2-[2-(4-methylanilino)-2-oxoethyl]sulfanylacetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 55982413 |
| Molecular Formula | C20H22FN3O3S |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 2-fluoro-N-[2-[[2-[2-(4-methylanilino)-2-oxoethyl]sulfanylacetyl]amino]ethyl]benzamide |
| SMILES | Cc1ccc(NC(=O)CSCC(=O)NCCNC(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C20H22FN3O3S/c1-14-6-8-15(9-7-14)24-19(26)13-28-12-18(25)22-10-11-23-20(27)16-4-2-3-5-17(16)21/h2-9H,10-13H2,1H3,(H,22,25)(H,23,27)(H,24,26) |
| InChIKey | DCHXAHZWELTMML-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|