C25H25FN2O2S2 — CID 26635919
N-[3-(4-fluorophenyl)sulfanylpropyl]-2-[2-(4-methylanilino)-2-oxoethyl]sulfanylbenzamide (PubChem CID 26635919) has the molecular formula C25H25FN2O2S2 and a molecular weight of 468.62 g/mol. Its IUPAC name is N-[3-(4-fluorophenyl)sulfanylpropyl]-2-[2-(4-methylanilino)-2-oxoethyl]sulfanylbenzamide.
| Compound Name | N-[3-(4-fluorophenyl)sulfanylpropyl]-2-[2-(4-methylanilino)-2-oxoethyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 26635919 |
| Molecular Formula | C25H25FN2O2S2 |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | N-[3-(4-fluorophenyl)sulfanylpropyl]-2-[2-(4-methylanilino)-2-oxoethyl]sulfanylbenzamide |
| SMILES | Cc1ccc(NC(=O)CSc2ccccc2C(=O)NCCCSc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H25FN2O2S2/c1-18-7-11-20(12-8-18)28-24(29)17-32-23-6-3-2-5-22(23)25(30)27-15-4-16-31-21-13-9-19(26)10-14-21/h2-3,5-14H,4,15-17H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | OYQLNUSXCFZRJU-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|