C23H22N2O2S2 — CID 112762736
2-[2-(4-methylanilino)-2-oxoethyl]sulfanyl-N-(3-methylsulfanylphenyl)benzamide (PubChem CID 112762736) has the molecular formula C23H22N2O2S2 and a molecular weight of 422.58 g/mol. Its IUPAC name is 2-[2-(4-methylanilino)-2-oxoethyl]sulfanyl-N-(3-methylsulfanylphenyl)benzamide.
| Compound Name | 2-[2-(4-methylanilino)-2-oxoethyl]sulfanyl-N-(3-methylsulfanylphenyl)benzamide |
|---|---|
| PubChem CID | 112762736 |
| Molecular Formula | C23H22N2O2S2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 2-[2-(4-methylanilino)-2-oxoethyl]sulfanyl-N-(3-methylsulfanylphenyl)benzamide |
| SMILES | CSc1cccc(NC(=O)c2ccccc2SCC(=O)Nc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C23H22N2O2S2/c1-16-10-12-17(13-11-16)24-22(26)15-29-21-9-4-3-8-20(21)23(27)25-18-6-5-7-19(14-18)28-2/h3-14H,15H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | DJVOROSSCHJLPU-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |