C24H20N4O2S — CID 112845760
2-[2-(4-methylanilino)-2-oxoethyl]sulfanyl-N-quinoxalin-6-ylbenzamide (PubChem CID 112845760) has the molecular formula C24H20N4O2S and a molecular weight of 428.52 g/mol. Its IUPAC name is 2-[2-(4-methylanilino)-2-oxoethyl]sulfanyl-N-quinoxalin-6-ylbenzamide.
| Compound Name | 2-[2-(4-methylanilino)-2-oxoethyl]sulfanyl-N-quinoxalin-6-ylbenzamide |
|---|---|
| PubChem CID | 112845760 |
| Molecular Formula | C24H20N4O2S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 2-[2-(4-methylanilino)-2-oxoethyl]sulfanyl-N-quinoxalin-6-ylbenzamide |
| SMILES | Cc1ccc(NC(=O)CSc2ccccc2C(=O)Nc2ccc3nccnc3c2)cc1 |
| InChI | InChI=1S/C24H20N4O2S/c1-16-6-8-17(9-7-16)27-23(29)15-31-22-5-3-2-4-19(22)24(30)28-18-10-11-20-21(14-18)26-13-12-25-20/h2-14H,15H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | SCPDPQUEBMEEDV-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |