C26H23N5O3S — CID 4858191
N-(4-methylphenyl)-2-[2-[[(3-phenyl-1H-pyrazole-5-carbonyl)amino]carbamoyl]phenyl]sulfanylacetamide (PubChem CID 4858191) has the molecular formula C26H23N5O3S and a molecular weight of 485.57 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[2-[[(3-phenyl-1H-pyrazole-5-carbonyl)amino]carbamoyl]phenyl]sulfanylacetamide.
| Compound Name | N-(4-methylphenyl)-2-[2-[[(3-phenyl-1H-pyrazole-5-carbonyl)amino]carbamoyl]phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 4858191 |
| Molecular Formula | C26H23N5O3S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | N-(4-methylphenyl)-2-[2-[[(3-phenyl-1H-pyrazole-5-carbonyl)amino]carbamoyl]phenyl]sulfanylacetamide |
| SMILES | Cc1ccc(NC(=O)CSc2ccccc2C(=O)NNC(=O)c2cc(-c3ccccc3)n[nH]2)cc1 |
| InChI | InChI=1S/C26H23N5O3S/c1-17-11-13-19(14-12-17)27-24(32)16-35-23-10-6-5-9-20(23)25(33)30-31-26(34)22-15-21(28-29-22)18-7-3-2-4-8-18/h2-15H,16H2,1H3,(H,27,32)(H,28,29)(H,30,33)(H,31,34) |
| InChIKey | RSTAMICFTURKGE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|