C20H21N5OS — CID 8889246
1-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]-3-(4-propan-2-ylphenyl)thiourea (PubChem CID 8889246) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is 1-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]-3-(4-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]-3-(4-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 8889246 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 1-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]-3-(4-propan-2-ylphenyl)thiourea |
| SMILES | CC(C)c1ccc(NC(=S)NNC(=O)c2cc(-c3ccccc3)n[nH]2)cc1 |
| InChI | InChI=1S/C20H21N5OS/c1-13(2)14-8-10-16(11-9-14)21-20(27)25-24-19(26)18-12-17(22-23-18)15-6-4-3-5-7-15/h3-13H,1-2H3,(H,22,23)(H,24,26)(H2,21,25,27) |
| InChIKey | QHNDVROBJPBWLX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_urea_C(9)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|