C24H20N4O2 — CID 4787905
N'-(2,2-diphenylacetyl)-3-phenyl-1H-pyrazole-5-carbohydrazide (PubChem CID 4787905) has the molecular formula C24H20N4O2 and a molecular weight of 396.45 g/mol. Its IUPAC name is N'-(2,2-diphenylacetyl)-3-phenyl-1H-pyrazole-5-carbohydrazide.
| Compound Name | N'-(2,2-diphenylacetyl)-3-phenyl-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 4787905 |
| Molecular Formula | C24H20N4O2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N'-(2,2-diphenylacetyl)-3-phenyl-1H-pyrazole-5-carbohydrazide |
| SMILES | O=C(NNC(=O)C(c1ccccc1)c1ccccc1)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C24H20N4O2/c29-23(21-16-20(25-26-21)17-10-4-1-5-11-17)27-28-24(30)22(18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-16,22H,(H,25,26)(H,27,29)(H,28,30) |
| InChIKey | PRKWECYYKMABTI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|