C19H14N4O — CID 174669259
bis(3-phenyl-1H-pyrazol-5-yl)methanone (PubChem CID 174669259) has the molecular formula C19H14N4O and a molecular weight of 314.35 g/mol. Its IUPAC name is bis(3-phenyl-1H-pyrazol-5-yl)methanone.
| Compound Name | bis(3-phenyl-1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 174669259 |
| Molecular Formula | C19H14N4O |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | bis(3-phenyl-1H-pyrazol-5-yl)methanone |
| SMILES | O=C(c1cc(-c2ccccc2)n[nH]1)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C19H14N4O/c24-19(17-11-15(20-22-17)13-7-3-1-4-8-13)18-12-16(21-23-18)14-9-5-2-6-10-14/h1-12H,(H,20,22)(H,21,23) |
| InChIKey | QBPOCLCLQLOKQO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |