C13H14N4O3 — CID 118877078
2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]ethylcarbamic acid (PubChem CID 118877078) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is 2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]ethylcarbamic acid.
| Compound Name | 2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]ethylcarbamic acid |
|---|---|
| PubChem CID | 118877078 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]ethylcarbamic acid |
| SMILES | O=C(O)NCCNC(=O)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C13H14N4O3/c18-12(14-6-7-15-13(19)20)11-8-10(16-17-11)9-4-2-1-3-5-9/h1-5,8,15H,6-7H2,(H,14,18)(H,16,17)(H,19,20) |
| InChIKey | YWUKKCCQADBZAO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|