C20H21N5O3 — CID 131990271
5-methyl-2-oxo-N-[3-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]propyl]-1H-pyridine-3-carboxamide (PubChem CID 131990271) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is 5-methyl-2-oxo-N-[3-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]propyl]-1H-pyridine-3-carboxamide.
| Compound Name | 5-methyl-2-oxo-N-[3-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]propyl]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 131990271 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 5-methyl-2-oxo-N-[3-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]propyl]-1H-pyridine-3-carboxamide |
| SMILES | Cc1c[nH]c(=O)c(C(=O)NCCCNC(=O)c2cc(-c3ccccc3)n[nH]2)c1 |
| InChI | InChI=1S/C20H21N5O3/c1-13-10-15(19(27)23-12-13)18(26)21-8-5-9-22-20(28)17-11-16(24-25-17)14-6-3-2-4-7-14/h2-4,6-7,10-12H,5,8-9H2,1H3,(H,21,26)(H,22,28)(H,23,27)(H,24,25) |
| InChIKey | YZWLGXYAPVANEM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 119.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|