C19H19N5O3 — CID 131991761
5-hydroxy-N-[3-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]propyl]pyridine-2-carboxamide (PubChem CID 131991761) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is 5-hydroxy-N-[3-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]propyl]pyridine-2-carboxamide.
| Compound Name | 5-hydroxy-N-[3-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]propyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 131991761 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 5-hydroxy-N-[3-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]propyl]pyridine-2-carboxamide |
| SMILES | O=C(NCCCNC(=O)c1cc(-c2ccccc2)n[nH]1)c1ccc(O)cn1 |
| InChI | InChI=1S/C19H19N5O3/c25-14-7-8-15(22-12-14)18(26)20-9-4-10-21-19(27)17-11-16(23-24-17)13-5-2-1-3-6-13/h1-3,5-8,11-12,25H,4,9-10H2,(H,20,26)(H,21,27)(H,23,24) |
| InChIKey | MWGSGINBBBMIJJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|