C25H23N5O2 — CID 131990295
4-phenyl-N-[3-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]propyl]pyridine-2-carboxamide (PubChem CID 131990295) has the molecular formula C25H23N5O2 and a molecular weight of 425.49 g/mol. Its IUPAC name is 4-phenyl-N-[3-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]propyl]pyridine-2-carboxamide.
| Compound Name | 4-phenyl-N-[3-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]propyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 131990295 |
| Molecular Formula | C25H23N5O2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 4-phenyl-N-[3-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]propyl]pyridine-2-carboxamide |
| SMILES | O=C(NCCCNC(=O)c1cc(-c2ccccc2)n[nH]1)c1cc(-c2ccccc2)ccn1 |
| InChI | InChI=1S/C25H23N5O2/c31-24(22-16-20(12-15-26-22)18-8-3-1-4-9-18)27-13-7-14-28-25(32)23-17-21(29-30-23)19-10-5-2-6-11-19/h1-6,8-12,15-17H,7,13-14H2,(H,27,31)(H,28,32)(H,29,30) |
| InChIKey | OADRTSJLFPJHBW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|