C17H17N5O2S — CID 122190961
N-[3-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]propyl]-1,3-thiazole-2-carboxamide (PubChem CID 122190961) has the molecular formula C17H17N5O2S and a molecular weight of 355.42 g/mol. Its IUPAC name is N-[3-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]propyl]-1,3-thiazole-2-carboxamide.
| Compound Name | N-[3-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]propyl]-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 122190961 |
| Molecular Formula | C17H17N5O2S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | N-[3-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]propyl]-1,3-thiazole-2-carboxamide |
| SMILES | O=C(NCCCNC(=O)c1nccs1)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C17H17N5O2S/c23-15(14-11-13(21-22-14)12-5-2-1-3-6-12)18-7-4-8-19-16(24)17-20-9-10-25-17/h1-3,5-6,9-11H,4,7-8H2,(H,18,23)(H,19,24)(H,21,22) |
| InChIKey | RHUMPIOPYLFYHR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|