C20H18F3N5O2 — CID 131990284
N-[3-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]propyl]-6-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 131990284) has the molecular formula C20H18F3N5O2 and a molecular weight of 417.39 g/mol. Its IUPAC name is N-[3-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]propyl]-6-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[3-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]propyl]-6-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 131990284 |
| Molecular Formula | C20H18F3N5O2 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | N-[3-[(3-phenyl-1H-pyrazole-5-carbonyl)amino]propyl]-6-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | O=C(NCCCNC(=O)c1cc(-c2ccccc2)n[nH]1)c1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C20H18F3N5O2/c21-20(22,23)17-9-4-8-14(26-17)18(29)24-10-5-11-25-19(30)16-12-15(27-28-16)13-6-2-1-3-7-13/h1-4,6-9,12H,5,10-11H2,(H,24,29)(H,25,30)(H,27,28) |
| InChIKey | ONTMVVRXNUGGLJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|