C18H17BrN4O3 — CID 131990274
N-[3-[(5-bromofuran-2-carbonyl)amino]propyl]-3-phenyl-1H-pyrazole-5-carboxamide (PubChem CID 131990274) has the molecular formula C18H17BrN4O3 and a molecular weight of 417.26 g/mol. Its IUPAC name is N-[3-[(5-bromofuran-2-carbonyl)amino]propyl]-3-phenyl-1H-pyrazole-5-carboxamide.
| Compound Name | N-[3-[(5-bromofuran-2-carbonyl)amino]propyl]-3-phenyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 131990274 |
| Molecular Formula | C18H17BrN4O3 |
| Molecular Weight | 417.26 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | N-[3-[(5-bromofuran-2-carbonyl)amino]propyl]-3-phenyl-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCCCNC(=O)c1ccc(Br)o1)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C18H17BrN4O3/c19-16-8-7-15(26-16)18(25)21-10-4-9-20-17(24)14-11-13(22-23-14)12-5-2-1-3-6-12/h1-3,5-8,11H,4,9-10H2,(H,20,24)(H,21,25)(H,22,23) |
| InChIKey | QAOPPCDIACMCLE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|