C8H11N3O2S — CID 110467918
N-(3-formamidopropyl)-1,3-thiazole-2-carboxamide (PubChem CID 110467918) has the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. Its IUPAC name is N-(3-formamidopropyl)-1,3-thiazole-2-carboxamide.
| Compound Name | N-(3-formamidopropyl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 110467918 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | N-(3-formamidopropyl)-1,3-thiazole-2-carboxamide |
| SMILES | O=CNCCCNC(=O)c1nccs1 |
| InChI | InChI=1S/C8H11N3O2S/c12-6-9-2-1-3-10-7(13)8-11-4-5-14-8/h4-6H,1-3H2,(H,9,12)(H,10,13) |
| InChIKey | OHBMLUUXFMKZPG-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|