C7H11N5O2 — CID 110475421
N-(3-formamidopropyl)-2H-triazole-4-carboxamide (PubChem CID 110475421) has the molecular formula C7H11N5O2 and a molecular weight of 197.20 g/mol. Its IUPAC name is N-(3-formamidopropyl)-2H-triazole-4-carboxamide.
| Compound Name | N-(3-formamidopropyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 110475421 |
| Molecular Formula | C7H11N5O2 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | N-(3-formamidopropyl)-2H-triazole-4-carboxamide |
| SMILES | O=CNCCCNC(=O)c1cn[nH]n1 |
| InChI | InChI=1S/C7H11N5O2/c13-5-8-2-1-3-9-7(14)6-4-10-12-11-6/h4-5H,1-3H2,(H,8,13)(H,9,14)(H,10,11,12) |
| InChIKey | GTEPWNABTWXEEB-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|