C6H10N6O2 — CID 78995318
N-[2-(carbamoylamino)ethyl]-2H-triazole-4-carboxamide (PubChem CID 78995318) has the molecular formula C6H10N6O2 and a molecular weight of 198.19 g/mol. Its IUPAC name is N-[2-(carbamoylamino)ethyl]-2H-triazole-4-carboxamide.
| Compound Name | N-[2-(carbamoylamino)ethyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 78995318 |
| Molecular Formula | C6H10N6O2 |
| Molecular Weight | 198.19 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | N-[2-(carbamoylamino)ethyl]-2H-triazole-4-carboxamide |
| SMILES | NC(=O)NCCNC(=O)c1cn[nH]n1 |
| InChI | InChI=1S/C6H10N6O2/c7-6(14)9-2-1-8-5(13)4-3-10-12-11-4/h3H,1-2H2,(H,8,13)(H3,7,9,14)(H,10,11,12) |
| InChIKey | GYIKRQNQDGNNKV-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.19 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|