C8H12N4O — CID 115628382
N-[(E)-pent-3-enyl]-2H-triazole-4-carboxamide (PubChem CID 115628382) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is N-[(E)-pent-3-enyl]-2H-triazole-4-carboxamide.
| Compound Name | N-[(E)-pent-3-enyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 115628382 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | N-[(E)-pent-3-enyl]-2H-triazole-4-carboxamide |
| SMILES | C/C=C/CCNC(=O)c1cn[nH]n1 |
| InChI | InChI=1S/C8H12N4O/c1-2-3-4-5-9-8(13)7-6-10-12-11-7/h2-3,6H,4-5H2,1H3,(H,9,13)(H,10,11,12)/b3-2+ |
| InChIKey | KNDCWPAJPJXEJL-NSCUHMNNSA-N |
| XLogP | 0.50 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|