C9H13N3O — CID 115629259
N-[(E)-pent-3-enyl]-1H-imidazole-5-carboxamide (PubChem CID 115629259) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is N-[(E)-pent-3-enyl]-1H-imidazole-5-carboxamide.
| Compound Name | N-[(E)-pent-3-enyl]-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 115629259 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | N-[(E)-pent-3-enyl]-1H-imidazole-5-carboxamide |
| SMILES | C/C=C/CCNC(=O)c1cnc[nH]1 |
| InChI | InChI=1S/C9H13N3O/c1-2-3-4-5-11-9(13)8-6-10-7-12-8/h2-3,6-7H,4-5H2,1H3,(H,10,12)(H,11,13)/b3-2+ |
| InChIKey | AFMJAGARMGBGTJ-NSCUHMNNSA-N |
| XLogP | 1.11 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|