About 1H-imidazole-5-carbohydrazide;hydrochloride
1H-imidazole-5-carbohydrazide;hydrochloride (PubChem CID 141069695) has the molecular formula C4H7ClN4O
and a molecular weight of 162.58 g/mol. Its IUPAC name is 1H-imidazole-5-carbohydrazide;hydrochloride.
Molecular Properties
| Compound Name | 1H-imidazole-5-carbohydrazide;hydrochloride |
| PubChem CID | 141069695 |
| Molecular Formula | C4H7ClN4O |
| Molecular Weight | 162.58 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | 1H-imidazole-5-carbohydrazide;hydrochloride |
| SMILES | Cl.NNC(=O)c1cnc[nH]1 |
| InChI | InChI=1S/C4H6N4O.ClH/c5-8-4(9)3-1-6-2-7-3;/h1-2H,5H2,(H,6,7)(H,8,9);1H |
| InChIKey | QQXUXKHALDRYBC-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.58 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1H-imidazole-5-carbohydrazide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazole-5-carbohydrazide;hydrochloride?
The IUPAC name of 1H-imidazole-5-carbohydrazide;hydrochloride (CID 141069695) is 1H-imidazole-5-carbohydrazide;hydrochloride.
What is the SMILES notation for 1H-imidazole-5-carbohydrazide;hydrochloride?
The canonical SMILES for 1H-imidazole-5-carbohydrazide;hydrochloride is Cl.NNC(=O)c1cnc[nH]1.
What is the InChIKey of 1H-imidazole-5-carbohydrazide;hydrochloride?
The InChIKey is QQXUXKHALDRYBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4O.ClH/c5-8-4(9)3-1-6-2-7-3;/h1-2H,5H2,(H,6,7)(H,8,9);1H.
What are the key properties of 1H-imidazole-5-carbohydrazide;hydrochloride?
1H-imidazole-5-carbohydrazide;hydrochloride has a molecular weight of 162.58 g/mol, XLogP of -0.56, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazole-5-carbohydrazide;hydrochloride is sourced from PubChem (CID 141069695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).