About 1H-imidazole-5-carboxylic acid;dihydrate
1H-imidazole-5-carboxylic acid;dihydrate (PubChem CID 140542846) has the molecular formula C4H8N2O4
and a molecular weight of 148.12 g/mol. Its IUPAC name is 1H-imidazole-5-carboxylic acid;dihydrate.
Molecular Properties
| Compound Name | 1H-imidazole-5-carboxylic acid;dihydrate |
| PubChem CID | 140542846 |
| Molecular Formula | C4H8N2O4 |
| Molecular Weight | 148.12 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | 1H-imidazole-5-carboxylic acid;dihydrate |
| SMILES | O.O.O=C(O)c1cnc[nH]1 |
| InChI | InChI=1S/C4H4N2O2.2H2O/c7-4(8)3-1-5-2-6-3;;/h1-2H,(H,5,6)(H,7,8);2*1H2 |
| InChIKey | QFXLJOZBLQUSDT-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.12 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-imidazole-5-carboxylic acid;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazole-5-carboxylic acid;dihydrate?
The IUPAC name of 1H-imidazole-5-carboxylic acid;dihydrate (CID 140542846) is 1H-imidazole-5-carboxylic acid;dihydrate.
What is the SMILES notation for 1H-imidazole-5-carboxylic acid;dihydrate?
The canonical SMILES for 1H-imidazole-5-carboxylic acid;dihydrate is O.O.O=C(O)c1cnc[nH]1.
What is the InChIKey of 1H-imidazole-5-carboxylic acid;dihydrate?
The InChIKey is QFXLJOZBLQUSDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2.2H2O/c7-4(8)3-1-5-2-6-3;;/h1-2H,(H,5,6)(H,7,8);2*1H2.
What are the key properties of 1H-imidazole-5-carboxylic acid;dihydrate?
1H-imidazole-5-carboxylic acid;dihydrate has a molecular weight of 148.12 g/mol, XLogP of -1.54, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazole-5-carboxylic acid;dihydrate is sourced from PubChem (CID 140542846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).