C14H22N2OS — CID 142955503
N-(4-cyclohexylbutyl)-1,3-thiazole-2-carboxamide (PubChem CID 142955503) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is N-(4-cyclohexylbutyl)-1,3-thiazole-2-carboxamide.
| Compound Name | N-(4-cyclohexylbutyl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 142955503 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | N-(4-cyclohexylbutyl)-1,3-thiazole-2-carboxamide |
| SMILES | O=C(NCCCCC1CCCCC1)c1nccs1 |
| InChI | InChI=1S/C14H22N2OS/c17-13(14-16-10-11-18-14)15-9-5-4-8-12-6-2-1-3-7-12/h10-12H,1-9H2,(H,15,17) |
| InChIKey | KLZQPSPEEFZOSF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|