C19H23N3O2S — CID 17362343
N-[3-(3-cyclohexylpropanoylamino)phenyl]-1,3-thiazole-2-carboxamide (PubChem CID 17362343) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is N-[3-(3-cyclohexylpropanoylamino)phenyl]-1,3-thiazole-2-carboxamide.
| Compound Name | N-[3-(3-cyclohexylpropanoylamino)phenyl]-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 17362343 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[3-(3-cyclohexylpropanoylamino)phenyl]-1,3-thiazole-2-carboxamide |
| SMILES | O=C(CCC1CCCCC1)Nc1cccc(NC(=O)c2nccs2)c1 |
| InChI | InChI=1S/C19H23N3O2S/c23-17(10-9-14-5-2-1-3-6-14)21-15-7-4-8-16(13-15)22-18(24)19-20-11-12-25-19/h4,7-8,11-14H,1-3,5-6,9-10H2,(H,21,23)(H,22,24) |
| InChIKey | NVGFSLMQAOMNII-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |