C8H11N3O3S — CID 67154487
2-amino-4-(1,3-thiazole-2-carbonylamino)butanoic acid (PubChem CID 67154487) has the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. Its IUPAC name is 2-amino-4-(1,3-thiazole-2-carbonylamino)butanoic acid.
| Compound Name | 2-amino-4-(1,3-thiazole-2-carbonylamino)butanoic acid |
|---|---|
| PubChem CID | 67154487 |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 2-amino-4-(1,3-thiazole-2-carbonylamino)butanoic acid |
| SMILES | NC(CCNC(=O)c1nccs1)C(=O)O |
| InChI | InChI=1S/C8H11N3O3S/c9-5(8(13)14)1-2-10-6(12)7-11-3-4-15-7/h3-5H,1-2,9H2,(H,10,12)(H,13,14) |
| InChIKey | GZLFCYGMDAIJHZ-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |